C30H50N6O6 — CID 86069046
6,9,12,26,29,32-hexaoxa-2,16,19,22,36,39-hexazatricyclo[35.3.1.117,21]dotetraconta-1(41),17(42),18,20,37,39-hexaene (PubChem CID 86069046) has the molecular formula C30H50N6O6 and a molecular weight of 590.77 g/mol. Its IUPAC name is 6,9,12,26,29,32-hexaoxa-2,16,19,22,36,39-hexazatricyclo[35.3.1.117,21]dotetraconta-1(41),17(42),18,20,37,39-hexaene.
| Compound Name | 6,9,12,26,29,32-hexaoxa-2,16,19,22,36,39-hexazatricyclo[35.3.1.117,21]dotetraconta-1(41),17(42),18,20,37,39-hexaene |
|---|---|
| PubChem CID | 86069046 |
| Molecular Formula | C30H50N6O6 |
| Molecular Weight | 590.77 g/mol |
| Exact Mass | 590.38 |
| IUPAC Name | 6,9,12,26,29,32-hexaoxa-2,16,19,22,36,39-hexazatricyclo[35.3.1.117,21]dotetraconta-1(41),17(42),18,20,37,39-hexaene |
| SMILES | c1ncc2cc1NCCCOCCOCCOCCCNc1cncc(c1)NCCCOCCOCCOCCCN2 |
| InChI | InChI=1S/C30H50N6O6/c1-5-33-27-21-28(24-31-23-27)34-6-2-10-39-15-19-42-20-16-40-12-4-8-36-30-22-29(25-32-26-30)35-7-3-11-38-14-18-41-17-13-37-9-1/h21-26,33-36H,1-20H2 |
| InChIKey | KNBAWFAHLFIZTB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 129.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.77 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |