C14H19BrN2O — CID 169082182
3-bromo-5-(1,2,3,6-tetrahydropyridin-2-yl)pyridine;oxolane (PubChem CID 169082182) has the molecular formula C14H19BrN2O and a molecular weight of 311.22 g/mol. Its IUPAC name is 3-bromo-5-(1,2,3,6-tetrahydropyridin-2-yl)pyridine;oxolane.
| Compound Name | 3-bromo-5-(1,2,3,6-tetrahydropyridin-2-yl)pyridine;oxolane |
|---|---|
| PubChem CID | 169082182 |
| Molecular Formula | C14H19BrN2O |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 3-bromo-5-(1,2,3,6-tetrahydropyridin-2-yl)pyridine;oxolane |
| SMILES | Brc1cncc(C2CC=CCN2)c1.C1CCOC1 |
| InChI | InChI=1S/C10H11BrN2.C4H8O/c11-9-5-8(6-12-7-9)10-3-1-2-4-13-10;1-2-4-5-3-1/h1-2,5-7,10,13H,3-4H2;1-4H2 |
| InChIKey | PEBDPRAZVIJJCD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|