C30H50N8O2 — CID 102314848
11,16-dioxa-1,5,7,20,22,26,29,34-octazatetracyclo[24.5.5.23,6.221,24]tetraconta-3,5,21,23,37,39-hexaene (PubChem CID 102314848) has the molecular formula C30H50N8O2 and a molecular weight of 554.78 g/mol. Its IUPAC name is 11,16-dioxa-1,5,7,20,22,26,29,34-octazatetracyclo[24.5.5.23,6.221,24]tetraconta-3,5,21,23,37,39-hexaene.
| Compound Name | 11,16-dioxa-1,5,7,20,22,26,29,34-octazatetracyclo[24.5.5.23,6.221,24]tetraconta-3,5,21,23,37,39-hexaene |
|---|---|
| PubChem CID | 102314848 |
| Molecular Formula | C30H50N8O2 |
| Molecular Weight | 554.78 g/mol |
| Exact Mass | 554.41 |
| IUPAC Name | 11,16-dioxa-1,5,7,20,22,26,29,34-octazatetracyclo[24.5.5.23,6.221,24]tetraconta-3,5,21,23,37,39-hexaene |
| SMILES | c1cc2ncc1CN1CCNCCN(CCNCC1)Cc1ccc(nc1)NCCCOCCCCOCCCN2 |
| InChI | InChI=1S/C30H50N8O2/c1-2-20-40-22-4-10-34-30-8-6-28(24-36-30)26-38-17-13-31-11-15-37(16-12-32-14-18-38)25-27-5-7-29(35-23-27)33-9-3-21-39-19-1/h5-8,23-24,31-32H,1-4,9-22,25-26H2,(H,33,35)(H,34,36) |
| InChIKey | QOWINIVYMFMZFR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 98.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.78 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |