About 4-(1H-pyrazol-5-yl)-1,4-oxazepane
4-(1H-pyrazol-5-yl)-1,4-oxazepane (PubChem CID 126655328) has the molecular formula C8H13N3O
and a molecular weight of 167.21 g/mol. Its IUPAC name is 4-(1H-pyrazol-5-yl)-1,4-oxazepane.
Molecular Properties
| Compound Name | 4-(1H-pyrazol-5-yl)-1,4-oxazepane |
| PubChem CID | 126655328 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 4-(1H-pyrazol-5-yl)-1,4-oxazepane |
| SMILES | c1cc(N2CCCOCC2)[nH]n1 |
| InChI | InChI=1S/C8H13N3O/c1-4-11(5-7-12-6-1)8-2-3-9-10-8/h2-3H,1,4-7H2,(H,9,10) |
| InChIKey | HMNAYLZWKWEVLN-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1H-pyrazol-5-yl)-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1H-pyrazol-5-yl)-1,4-oxazepane?
The IUPAC name of 4-(1H-pyrazol-5-yl)-1,4-oxazepane (CID 126655328) is 4-(1H-pyrazol-5-yl)-1,4-oxazepane.
What is the SMILES notation for 4-(1H-pyrazol-5-yl)-1,4-oxazepane?
The canonical SMILES for 4-(1H-pyrazol-5-yl)-1,4-oxazepane is c1cc(N2CCCOCC2)[nH]n1.
What is the InChIKey of 4-(1H-pyrazol-5-yl)-1,4-oxazepane?
The InChIKey is HMNAYLZWKWEVLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O/c1-4-11(5-7-12-6-1)8-2-3-9-10-8/h2-3H,1,4-7H2,(H,9,10).
What are the key properties of 4-(1H-pyrazol-5-yl)-1,4-oxazepane?
4-(1H-pyrazol-5-yl)-1,4-oxazepane has a molecular weight of 167.21 g/mol, XLogP of 0.64, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1H-pyrazol-5-yl)-1,4-oxazepane is sourced from PubChem (CID 126655328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).