C25H29N7OS — CID 155585725
ethene;N-[2-[6-(1,4-oxazepan-4-yl)-1-(1H-pyrazol-5-yl)pyrazolo[5,4-b]pyridin-4-yl]phenyl]sulfanylcyclopropanamine (PubChem CID 155585725) has the molecular formula C25H29N7OS and a molecular weight of 475.62 g/mol. Its IUPAC name is ethene;N-[2-[6-(1,4-oxazepan-4-yl)-1-(1H-pyrazol-5-yl)pyrazolo[5,4-b]pyridin-4-yl]phenyl]sulfanylcyclopropanamine.
| Compound Name | ethene;N-[2-[6-(1,4-oxazepan-4-yl)-1-(1H-pyrazol-5-yl)pyrazolo[5,4-b]pyridin-4-yl]phenyl]sulfanylcyclopropanamine |
|---|---|
| PubChem CID | 155585725 |
| Molecular Formula | C25H29N7OS |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | ethene;N-[2-[6-(1,4-oxazepan-4-yl)-1-(1H-pyrazol-5-yl)pyrazolo[5,4-b]pyridin-4-yl]phenyl]sulfanylcyclopropanamine |
| SMILES | C=C.c1ccc(-c2cc(N3CCCOCC3)nc3c2cnn3-c2ccn[nH]2)c(SNC2CC2)c1 |
| InChI | InChI=1S/C23H25N7OS.C2H4/c1-2-5-20(32-28-16-6-7-16)17(4-1)18-14-22(29-10-3-12-31-13-11-29)26-23-19(18)15-25-30(23)21-8-9-24-27-21;1-2/h1-2,4-5,8-9,14-16,28H,3,6-7,10-13H2,(H,24,27);1-2H2 |
| InChIKey | WSDTUYRZEOCQDB-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|