C21H32F2N8O — CID 155585703
cyclohexyl(difluoro)methanamine;methanamine;4-[1-(1H-pyrazol-5-yl)pyrazolo[5,4-b]pyridin-6-yl]morpholine (PubChem CID 155585703) has the molecular formula C21H32F2N8O and a molecular weight of 450.54 g/mol. Its IUPAC name is cyclohexyl(difluoro)methanamine;methanamine;4-[1-(1H-pyrazol-5-yl)pyrazolo[5,4-b]pyridin-6-yl]morpholine.
| Compound Name | cyclohexyl(difluoro)methanamine;methanamine;4-[1-(1H-pyrazol-5-yl)pyrazolo[5,4-b]pyridin-6-yl]morpholine |
|---|---|
| PubChem CID | 155585703 |
| Molecular Formula | C21H32F2N8O |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | cyclohexyl(difluoro)methanamine;methanamine;4-[1-(1H-pyrazol-5-yl)pyrazolo[5,4-b]pyridin-6-yl]morpholine |
| SMILES | CN.NC(F)(F)C1CCCCC1.c1cc(-n2ncc3ccc(N4CCOCC4)nc32)[nH]n1 |
| InChI | InChI=1S/C13H14N6O.C7H13F2N.CH5N/c1-2-11(18-5-7-20-8-6-18)16-13-10(1)9-15-19(13)12-3-4-14-17-12;8-7(9,10)6-4-2-1-3-5-6;1-2/h1-4,9H,5-8H2,(H,14,17);6H,1-5,10H2;2H2,1H3 |
| InChIKey | HIXPQLCEMCZROD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 123.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|