C17H17N5O — CID 167842873
2-[5-(4-piperazin-1-ylphenyl)pyrimidin-2-yl]-1,3-oxazole (PubChem CID 167842873) has the molecular formula C17H17N5O and a molecular weight of 307.36 g/mol. Its IUPAC name is 2-[5-(4-piperazin-1-ylphenyl)pyrimidin-2-yl]-1,3-oxazole.
| Compound Name | 2-[5-(4-piperazin-1-ylphenyl)pyrimidin-2-yl]-1,3-oxazole |
|---|---|
| PubChem CID | 167842873 |
| Molecular Formula | C17H17N5O |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 2-[5-(4-piperazin-1-ylphenyl)pyrimidin-2-yl]-1,3-oxazole |
| SMILES | c1coc(-c2ncc(-c3ccc(N4CCNCC4)cc3)cn2)n1 |
| InChI | InChI=1S/C17H17N5O/c1-3-15(22-8-5-18-6-9-22)4-2-13(1)14-11-20-16(21-12-14)17-19-7-10-23-17/h1-4,7,10-12,18H,5-6,8-9H2 |
| InChIKey | GZONAUWQFULVMZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 67.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |