C18H33N5 — CID 165352114
3,7,10,13,17-pentazabicyclo[17.3.1]tricosa-1(23),19,21-triene (PubChem CID 165352114) has the molecular formula C18H33N5 and a molecular weight of 319.50 g/mol. Its IUPAC name is 3,7,10,13,17-pentazabicyclo[17.3.1]tricosa-1(23),19,21-triene.
| Compound Name | 3,7,10,13,17-pentazabicyclo[17.3.1]tricosa-1(23),19,21-triene |
|---|---|
| PubChem CID | 165352114 |
| Molecular Formula | C18H33N5 |
| Molecular Weight | 319.50 g/mol |
| Exact Mass | 319.27 |
| IUPAC Name | 3,7,10,13,17-pentazabicyclo[17.3.1]tricosa-1(23),19,21-triene |
| SMILES | c1cc2cc(c1)CNCCCNCCNCCNCCCNC2 |
| InChI | InChI=1S/C18H33N5/c1-4-17-14-18(5-1)16-23-9-3-7-20-11-13-21-12-10-19-6-2-8-22-15-17/h1,4-5,14,19-23H,2-3,6-13,15-16H2 |
| InChIKey | HCRSUFMTYNFZCM-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.50 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |