C16H28N4 — CID 10446177
3,7,10,14-tetrazabicyclo[14.2.2]icosa-1(18),16,19-triene (PubChem CID 10446177) has the molecular formula C16H28N4 and a molecular weight of 276.43 g/mol. Its IUPAC name is 3,7,10,14-tetrazabicyclo[14.2.2]icosa-1(18),16,19-triene.
| Compound Name | 3,7,10,14-tetrazabicyclo[14.2.2]icosa-1(18),16,19-triene |
|---|---|
| PubChem CID | 10446177 |
| Molecular Formula | C16H28N4 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | 3,7,10,14-tetrazabicyclo[14.2.2]icosa-1(18),16,19-triene |
| SMILES | c1cc2ccc1CNCCCNCCNCCCNC2 |
| InChI | InChI=1S/C16H28N4/c1-7-17-11-12-18-8-2-10-20-14-16-5-3-15(4-6-16)13-19-9-1/h3-6,17-20H,1-2,7-14H2 |
| InChIKey | ZSXBFNCRHNWYDC-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |