C13H19CuN5O2+2 — CID 139245973
copper 3,6,9,12,18-pentazabicyclo[12.3.1]octadeca-1(18),14,16-triene-2,13-dione (PubChem CID 139245973) has the molecular formula C13H19CuN5O2+2 and a molecular weight of 340.87 g/mol. Its IUPAC name is copper 3,6,9,12,18-pentazabicyclo[12.3.1]octadeca-1(18),14,16-triene-2,13-dione.
| Compound Name | copper 3,6,9,12,18-pentazabicyclo[12.3.1]octadeca-1(18),14,16-triene-2,13-dione |
|---|---|
| PubChem CID | 139245973 |
| Molecular Formula | C13H19CuN5O2+2 |
| Molecular Weight | 340.87 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | copper 3,6,9,12,18-pentazabicyclo[12.3.1]octadeca-1(18),14,16-triene-2,13-dione |
| SMILES | O=C1NCCNCCNCCNC(=O)c2cccc1n2.[Cu+2] |
| InChI | InChI=1S/C13H19N5O2.Cu/c19-12-10-2-1-3-11(18-10)13(20)17-9-7-15-5-4-14-6-8-16-12;/h1-3,14-15H,4-9H2,(H,16,19)(H,17,20);/q;+2 |
| InChIKey | FMZZPAGGVSXRDZ-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 95.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.87 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |