C23H35N3O8 — CID 102236242
(14Z)-6,9,12,17,20,23-hexaoxa-3,26,32-triazabicyclo[26.3.1]dotriaconta-1(32),14,28,30-tetraene-2,27-dione (PubChem CID 102236242) has the molecular formula C23H35N3O8 and a molecular weight of 481.55 g/mol. Its IUPAC name is (14Z)-6,9,12,17,20,23-hexaoxa-3,26,32-triazabicyclo[26.3.1]dotriaconta-1(32),14,28,30-tetraene-2,27-dione.
| Compound Name | (14Z)-6,9,12,17,20,23-hexaoxa-3,26,32-triazabicyclo[26.3.1]dotriaconta-1(32),14,28,30-tetraene-2,27-dione |
|---|---|
| PubChem CID | 102236242 |
| Molecular Formula | C23H35N3O8 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | (14Z)-6,9,12,17,20,23-hexaoxa-3,26,32-triazabicyclo[26.3.1]dotriaconta-1(32),14,28,30-tetraene-2,27-dione |
| SMILES | O=C1NCCOCCOCCOC/C=C\COCCOCCOCCNC(=O)c2cccc1n2 |
| InChI | InChI=1S/C23H35N3O8/c27-22-20-4-3-5-21(26-20)23(28)25-7-11-32-15-19-34-17-13-30-9-2-1-8-29-12-16-33-18-14-31-10-6-24-22/h1-5H,6-19H2,(H,24,27)(H,25,28)/b2-1- |
| InChIKey | GPDLJYBNWBCJST-UPHRSURJSA-N |
| XLogP | 0.21 |
| TPSA | 126.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|