C33H33N3O15 — CID 100941709
3,6,9,17,20,23,31,34,37-nonaoxa-43,44,45-triazatetracyclo[37.3.1.111,15.125,29]pentatetraconta-1(43),11(45),12,14,25,27,29(44),39,41-nonaene-2,10,16,24,30,38-hexone (PubChem CID 100941709) has the molecular formula C33H33N3O15 and a molecular weight of 711.63 g/mol. Its IUPAC name is 3,6,9,17,20,23,31,34,37-nonaoxa-43,44,45-triazatetracyclo[37.3.1.111,15.125,29]pentatetraconta-1(43),11(45),12,14,25,27,29(44),39,41-nonaene-2,10,16,24,30,38-hexone.
| Compound Name | 3,6,9,17,20,23,31,34,37-nonaoxa-43,44,45-triazatetracyclo[37.3.1.111,15.125,29]pentatetraconta-1(43),11(45),12,14,25,27,29(44),39,41-nonaene-2,10,16,24,30,38-hexone |
|---|---|
| PubChem CID | 100941709 |
| Molecular Formula | C33H33N3O15 |
| Molecular Weight | 711.63 g/mol |
| Exact Mass | 711.19 |
| IUPAC Name | 3,6,9,17,20,23,31,34,37-nonaoxa-43,44,45-triazatetracyclo[37.3.1.111,15.125,29]pentatetraconta-1(43),11(45),12,14,25,27,29(44),39,41-nonaene-2,10,16,24,30,38-hexone |
| SMILES | O=C1OCCOCCOC(=O)c2cccc(n2)C(=O)OCCOCCOC(=O)c2cccc(n2)C(=O)OCCOCCOC(=O)c2cccc1n2 |
| InChI | InChI=1S/C33H33N3O15/c37-28-22-4-1-5-23(34-22)29(38)47-17-11-44-13-19-49-31(40)25-7-3-9-27(36-25)33(42)51-21-15-45-14-20-50-32(41)26-8-2-6-24(35-26)30(39)48-18-12-43-10-16-46-28/h1-9H,10-21H2 |
| InChIKey | GQHWPPRIUYKGJL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 224.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.63 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|