C8H12O6 — CID 159785503
1,4-dioxane;1,4-dioxane-2,3-dione (PubChem CID 159785503) has the molecular formula C8H12O6 and a molecular weight of 204.18 g/mol. Its IUPAC name is 1,4-dioxane;1,4-dioxane-2,3-dione.
| Compound Name | 1,4-dioxane;1,4-dioxane-2,3-dione |
|---|---|
| PubChem CID | 159785503 |
| Molecular Formula | C8H12O6 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 1,4-dioxane;1,4-dioxane-2,3-dione |
| SMILES | C1COCCO1.O=C1OCCOC1=O |
| InChI | InChI=1S/C4H4O4.C4H8O2/c5-3-4(6)8-2-1-7-3;1-2-6-4-3-5-1/h1-2H2;1-4H2 |
| InChIKey | NHWXGHBRJRXVBS-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|