C28H30O11 — CID 177487013
(5E)-3,8,17,20,23,26,29-heptaoxatricyclo[29.4.0.010,15]pentatriaconta-1(35),5,10,12,14,31,33-heptaene-2,9,16,30-tetrone (PubChem CID 177487013) has the molecular formula C28H30O11 and a molecular weight of 542.54 g/mol. Its IUPAC name is (5E)-3,8,17,20,23,26,29-heptaoxatricyclo[29.4.0.010,15]pentatriaconta-1(35),5,10,12,14,31,33-heptaene-2,9,16,30-tetrone.
| Compound Name | (5E)-3,8,17,20,23,26,29-heptaoxatricyclo[29.4.0.010,15]pentatriaconta-1(35),5,10,12,14,31,33-heptaene-2,9,16,30-tetrone |
|---|---|
| PubChem CID | 177487013 |
| Molecular Formula | C28H30O11 |
| Molecular Weight | 542.54 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | (5E)-3,8,17,20,23,26,29-heptaoxatricyclo[29.4.0.010,15]pentatriaconta-1(35),5,10,12,14,31,33-heptaene-2,9,16,30-tetrone |
| SMILES | O=C1OC/C=C/COC(=O)c2ccccc2C(=O)OCCOCCOCCOCCOC(=O)c2ccccc21 |
| InChI | InChI=1S/C28H30O11/c29-25-21-7-1-3-9-23(21)27(31)38-19-17-34-15-13-33-14-16-35-18-20-39-28(32)24-10-4-2-8-22(24)26(30)37-12-6-5-11-36-25/h1-10H,11-20H2/b6-5+ |
| InChIKey | RXDYZDOBZNGGOL-AATRIKPKSA-N |
| XLogP | 2.63 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.54 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|