C40H38O11 — CID 102049042
(11Z)-9,14,29,32,35,38,41-heptaoxapentacyclo[41.4.0.02,7.016,21.022,27]heptatetraconta-1(47),2,4,6,11,16,18,20,22,24,26,43,45-tridecaene-8,15,28,42-tetrone (PubChem CID 102049042) has the molecular formula C40H38O11 and a molecular weight of 694.73 g/mol. Its IUPAC name is (11Z)-9,14,29,32,35,38,41-heptaoxapentacyclo[41.4.0.02,7.016,21.022,27]heptatetraconta-1(47),2,4,6,11,16,18,20,22,24,26,43,45-tridecaene-8,15,28,42-tetrone.
| Compound Name | (11Z)-9,14,29,32,35,38,41-heptaoxapentacyclo[41.4.0.02,7.016,21.022,27]heptatetraconta-1(47),2,4,6,11,16,18,20,22,24,26,43,45-tridecaene-8,15,28,42-tetrone |
|---|---|
| PubChem CID | 102049042 |
| Molecular Formula | C40H38O11 |
| Molecular Weight | 694.73 g/mol |
| Exact Mass | 694.24 |
| IUPAC Name | (11Z)-9,14,29,32,35,38,41-heptaoxapentacyclo[41.4.0.02,7.016,21.022,27]heptatetraconta-1(47),2,4,6,11,16,18,20,22,24,26,43,45-tridecaene-8,15,28,42-tetrone |
| SMILES | O=C1OC/C=C\COC(=O)c2ccccc2-c2ccccc2C(=O)OCCOCCOCCOCCOC(=O)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C40H38O11/c41-37-33-15-5-1-11-29(33)31-13-3-7-17-35(31)39(43)50-27-25-46-23-21-45-22-24-47-26-28-51-40(44)36-18-8-4-14-32(36)30-12-2-6-16-34(30)38(42)49-20-10-9-19-48-37/h1-18H,19-28H2/b10-9- |
| InChIKey | YHUWVVPLILGMFT-KTKRTIGZSA-N |
| XLogP | 5.97 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.73 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|