C39H47N5O10 — CID 102340443
36,38-dipyridin-4-yl-2,5,8,11,25,28,31,34-octaoxa-14,22,40-triazatricyclo[33.2.2.116,20]tetraconta-1(37),16,18,20(40),35,38-hexaene-15,21-dione (PubChem CID 102340443) has the molecular formula C39H47N5O10 and a molecular weight of 745.83 g/mol. Its IUPAC name is 36,38-dipyridin-4-yl-2,5,8,11,25,28,31,34-octaoxa-14,22,40-triazatricyclo[33.2.2.116,20]tetraconta-1(37),16,18,20(40),35,38-hexaene-15,21-dione.
| Compound Name | 36,38-dipyridin-4-yl-2,5,8,11,25,28,31,34-octaoxa-14,22,40-triazatricyclo[33.2.2.116,20]tetraconta-1(37),16,18,20(40),35,38-hexaene-15,21-dione |
|---|---|
| PubChem CID | 102340443 |
| Molecular Formula | C39H47N5O10 |
| Molecular Weight | 745.83 g/mol |
| Exact Mass | 745.33 |
| IUPAC Name | 36,38-dipyridin-4-yl-2,5,8,11,25,28,31,34-octaoxa-14,22,40-triazatricyclo[33.2.2.116,20]tetraconta-1(37),16,18,20(40),35,38-hexaene-15,21-dione |
| SMILES | O=C1NCCOCCOCCOCCOc2cc(-c3ccncc3)c(cc2-c2ccncc2)OCCOCCOCCOCCNC(=O)c2cccc1n2 |
| InChI | InChI=1S/C39H47N5O10/c45-38-34-2-1-3-35(44-34)39(46)43-13-15-48-17-19-50-21-23-52-25-27-54-37-29-32(30-4-8-40-9-5-30)36(28-33(37)31-6-10-41-11-7-31)53-26-24-51-22-20-49-18-16-47-14-12-42-38/h1-11,28-29H,12-27H2,(H,42,45)(H,43,46) |
| InChIKey | ASSZHAOAAKQMNM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 170.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.83 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|