C25H23N3O6 — CID 177498431
3-methyl-2,11,20-trioxa-5,14,23-triazatetracyclo[22.3.1.16,10.115,19]triaconta-1(27),6(30),7,9,15(29),16,18,24(28),25-nonaene-4,13,22-trione (PubChem CID 177498431) has the molecular formula C25H23N3O6 and a molecular weight of 461.47 g/mol. Its IUPAC name is 3-methyl-2,11,20-trioxa-5,14,23-triazatetracyclo[22.3.1.16,10.115,19]triaconta-1(27),6(30),7,9,15(29),16,18,24(28),25-nonaene-4,13,22-trione.
| Compound Name | 3-methyl-2,11,20-trioxa-5,14,23-triazatetracyclo[22.3.1.16,10.115,19]triaconta-1(27),6(30),7,9,15(29),16,18,24(28),25-nonaene-4,13,22-trione |
|---|---|
| PubChem CID | 177498431 |
| Molecular Formula | C25H23N3O6 |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 3-methyl-2,11,20-trioxa-5,14,23-triazatetracyclo[22.3.1.16,10.115,19]triaconta-1(27),6(30),7,9,15(29),16,18,24(28),25-nonaene-4,13,22-trione |
| SMILES | CC1Oc2cccc(c2)NC(=O)COc2cccc(c2)NC(=O)COc2cccc(c2)NC1=O |
| InChI | InChI=1S/C25H23N3O6/c1-16-25(31)28-19-7-3-9-21(12-19)33-14-23(29)26-17-5-2-8-20(11-17)32-15-24(30)27-18-6-4-10-22(13-18)34-16/h2-13,16H,14-15H2,1H3,(H,26,29)(H,27,30)(H,28,31) |
| InChIKey | CMEDWEAZBFTAQQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |