About CID 70546334
CID 70546334 (PubChem CID 70546334) has the molecular formula C4H5KNO3
and a molecular weight of 154.19 g/mol.
Molecular Properties
| Compound Name | CID 70546334 |
| PubChem CID | 70546334 |
| Molecular Formula | C4H5KNO3 |
| Molecular Weight | 154.19 g/mol |
| Exact Mass | 153.99 |
| IUPAC Name | — |
| SMILES | CC1OC(=O)NC1=O.[K] |
| InChI | InChI=1S/C4H5NO3.K/c1-2-3(6)5-4(7)8-2;/h2H,1H3,(H,5,6,7); |
| InChIKey | RNRPIFJRQWFFHC-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.19 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 70546334 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 70546334?
The IUPAC name of CID 70546334 (CID 70546334) is not available.
What is the SMILES notation for CID 70546334?
The canonical SMILES for CID 70546334 is CC1OC(=O)NC1=O.[K].
What is the InChIKey of CID 70546334?
The InChIKey is RNRPIFJRQWFFHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO3.K/c1-2-3(6)5-4(7)8-2;/h2H,1H3,(H,5,6,7);.
What are the key properties of CID 70546334?
CID 70546334 has a molecular weight of 154.19 g/mol, XLogP of -0.74, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 70546334 is sourced from PubChem (CID 70546334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).