C4H5KNO3 — CID 70546334
CID 70546334 (PubChem CID 70546334) has the molecular formula C4H5KNO3 and a molecular weight of 154.19 g/mol.
| Compound Name | CID 70546334 |
|---|---|
| PubChem CID | 70546334 |
| Molecular Formula | C4H5KNO3 |
| Molecular Weight | 154.19 g/mol |
| Exact Mass | 153.99 |
| IUPAC Name | — |
| SMILES | CC1OC(=O)NC1=O.[K] |
| InChI | InChI=1S/C4H5NO3.K/c1-2-3(6)5-4(7)8-2;/h2H,1H3,(H,5,6,7); |
| InChIKey | RNRPIFJRQWFFHC-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.19 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |