C12H21NO3 — CID 167328506
5,6-ditert-butyl-1,3-oxazinane-2,4-dione (PubChem CID 167328506) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is 5,6-ditert-butyl-1,3-oxazinane-2,4-dione.
| Compound Name | 5,6-ditert-butyl-1,3-oxazinane-2,4-dione |
|---|---|
| PubChem CID | 167328506 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 5,6-ditert-butyl-1,3-oxazinane-2,4-dione |
| SMILES | CC(C)(C)C1OC(=O)NC(=O)C1C(C)(C)C |
| InChI | InChI=1S/C12H21NO3/c1-11(2,3)7-8(12(4,5)6)16-10(15)13-9(7)14/h7-8H,1-6H3,(H,13,14,15) |
| InChIKey | KTOZSCJBDPEZAD-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |