About ethane;5-methyl-1,3-oxazolidine-2,4-dione;molecular hydrogen
ethane;5-methyl-1,3-oxazolidine-2,4-dione;molecular hydrogen (PubChem CID 144512967) has the molecular formula C6H13NO3
and a molecular weight of 147.17 g/mol. Its IUPAC name is ethane;5-methyl-1,3-oxazolidine-2,4-dione;molecular hydrogen.
Analyze ethane;5-methyl-1,3-oxazolidine-2,4-dione;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methyl-1,3-oxazolidine-2,4-dione;molecular hydrogen?
The IUPAC name of ethane;5-methyl-1,3-oxazolidine-2,4-dione;molecular hydrogen (CID 144512967) is ethane;5-methyl-1,3-oxazolidine-2,4-dione;molecular hydrogen.
What is the SMILES notation for ethane;5-methyl-1,3-oxazolidine-2,4-dione;molecular hydrogen?
The canonical SMILES for ethane;5-methyl-1,3-oxazolidine-2,4-dione;molecular hydrogen is CC.CC1OC(=O)NC1=O.[H][H].
What is the InChIKey of ethane;5-methyl-1,3-oxazolidine-2,4-dione;molecular hydrogen?
The InChIKey is TYDIDJQLHYWEKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO3.C2H6.H2/c1-2-3(6)5-4(7)8-2;1-2;/h2H,1H3,(H,5,6,7);1-2H3;1H.
What are the key properties of ethane;5-methyl-1,3-oxazolidine-2,4-dione;molecular hydrogen?
ethane;5-methyl-1,3-oxazolidine-2,4-dione;molecular hydrogen has a molecular weight of 147.17 g/mol, XLogP of 0.91, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methyl-1,3-oxazolidine-2,4-dione;molecular hydrogen is sourced from PubChem (CID 144512967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).