C10H11NO2S — CID 82355440
2-methyl-6-methylsulfanyl-4H-1,4-benzoxazin-3-one (PubChem CID 82355440) has the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. Its IUPAC name is 2-methyl-6-methylsulfanyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 2-methyl-6-methylsulfanyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82355440 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 2-methyl-6-methylsulfanyl-4H-1,4-benzoxazin-3-one |
| SMILES | CSc1ccc2c(c1)NC(=O)C(C)O2 |
| InChI | InChI=1S/C10H11NO2S/c1-6-10(12)11-8-5-7(14-2)3-4-9(8)13-6/h3-6H,1-2H3,(H,11,12) |
| InChIKey | GQQNQNPQKBGHPW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |