C13H24O2 — CID 164734446
2,3-ditert-butyloxan-4-one (PubChem CID 164734446) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is 2,3-ditert-butyloxan-4-one.
| Compound Name | 2,3-ditert-butyloxan-4-one |
|---|---|
| PubChem CID | 164734446 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 2,3-ditert-butyloxan-4-one |
| SMILES | CC(C)(C)C1OCCC(=O)C1C(C)(C)C |
| InChI | InChI=1S/C13H24O2/c1-12(2,3)10-9(14)7-8-15-11(10)13(4,5)6/h10-11H,7-8H2,1-6H3 |
| InChIKey | OUZYGGPDOIUMGF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |