C7H12NNaO3 — CID 173208039
sodium;5-butyl-1,3-oxazolidine-2,4-dione;hydride (PubChem CID 173208039) has the molecular formula C7H12NNaO3 and a molecular weight of 181.17 g/mol. Its IUPAC name is sodium;5-butyl-1,3-oxazolidine-2,4-dione;hydride.
| Compound Name | sodium;5-butyl-1,3-oxazolidine-2,4-dione;hydride |
|---|---|
| PubChem CID | 173208039 |
| Molecular Formula | C7H12NNaO3 |
| Molecular Weight | 181.17 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | sodium;5-butyl-1,3-oxazolidine-2,4-dione;hydride |
| SMILES | CCCCC1OC(=O)NC1=O.[H-].[Na+] |
| InChI | InChI=1S/C7H11NO3.Na.H/c1-2-3-4-5-6(9)8-7(10)11-5;;/h5H,2-4H2,1H3,(H,8,9,10);;/q;+1;-1 |
| InChIKey | IBRQOAFFASKEKR-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.17 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |