C7H12N2OS — CID 131856782
(5S)-5-butyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 131856782) has the molecular formula C7H12N2OS and a molecular weight of 172.25 g/mol. Its IUPAC name is (5S)-5-butyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5S)-5-butyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 131856782 |
| Molecular Formula | C7H12N2OS |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | (5S)-5-butyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCCC[C@@H]1NC(=S)NC1=O |
| InChI | InChI=1S/C7H12N2OS/c1-2-3-4-5-6(10)9-7(11)8-5/h5H,2-4H2,1H3,(H2,8,9,10,11)/t5-/m0/s1 |
| InChIKey | OUNZMXALNUFHLW-YFKPBYRVSA-N |
| XLogP | 0.55 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|