C20H32N2O5S — CID 146356521
10-[3-(5-oxo-2-sulfanylideneimidazolidin-4-yl)propanoyloxy]decyl 2-methylprop-2-enoate (PubChem CID 146356521) has the molecular formula C20H32N2O5S and a molecular weight of 412.55 g/mol. Its IUPAC name is 10-[3-(5-oxo-2-sulfanylideneimidazolidin-4-yl)propanoyloxy]decyl 2-methylprop-2-enoate.
| Compound Name | 10-[3-(5-oxo-2-sulfanylideneimidazolidin-4-yl)propanoyloxy]decyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146356521 |
| Molecular Formula | C20H32N2O5S |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 10-[3-(5-oxo-2-sulfanylideneimidazolidin-4-yl)propanoyloxy]decyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCCCCCOC(=O)CCC1NC(=S)NC1=O |
| InChI | InChI=1S/C20H32N2O5S/c1-15(2)19(25)27-14-10-8-6-4-3-5-7-9-13-26-17(23)12-11-16-18(24)22-20(28)21-16/h16H,1,3-14H2,2H3,(H2,21,22,24,28) |
| InChIKey | QUTVSFUFMDLBLD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|