C7H12N2OS2 — CID 103090618
5-(3-methylsulfanylpropyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 103090618) has the molecular formula C7H12N2OS2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 5-(3-methylsulfanylpropyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 5-(3-methylsulfanylpropyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 103090618 |
| Molecular Formula | C7H12N2OS2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | 5-(3-methylsulfanylpropyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | CSCCCC1NC(=S)NC1=O |
| InChI | InChI=1S/C7H12N2OS2/c1-12-4-2-3-5-6(10)9-7(11)8-5/h5H,2-4H2,1H3,(H2,8,9,10,11) |
| InChIKey | SMODQNWYWQHYIJ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|