C17H26N4O4S — CID 22854541
(2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;5-[3-(dimethylamino)propyl]-2-sulfanylideneimidazolidin-4-one (PubChem CID 22854541) has the molecular formula C17H26N4O4S and a molecular weight of 382.49 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;5-[3-(dimethylamino)propyl]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;5-[3-(dimethylamino)propyl]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 22854541 |
| Molecular Formula | C17H26N4O4S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid;5-[3-(dimethylamino)propyl]-2-sulfanylideneimidazolidin-4-one |
| SMILES | CN(C)CCCC1NC(=S)NC1=O.N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C9H11NO3.C8H15N3OS/c10-8(9(12)13)5-6-1-3-7(11)4-2-6;1-11(2)5-3-4-6-7(12)10-8(13)9-6/h1-4,8,11H,5,10H2,(H,12,13);6H,3-5H2,1-2H3,(H2,9,10,12,13)/t8-;/m0./s1 |
| InChIKey | XAPRCUASLDOXGW-QRPNPIFTSA-N |
| XLogP | 0.05 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|