C11H14N2NaO3 — CID 70390787
CID 70390787 (PubChem CID 70390787) has the molecular formula C11H14N2NaO3 and a molecular weight of 245.23 g/mol.
| Compound Name | CID 70390787 |
|---|---|
| PubChem CID | 70390787 |
| Molecular Formula | C11H14N2NaO3 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | — |
| SMILES | CCCCn1cccc1C1OC(=O)NC1=O.[Na] |
| InChI | InChI=1S/C11H14N2O3.Na/c1-2-3-6-13-7-4-5-8(13)9-10(14)12-11(15)16-9;/h4-5,7,9H,2-3,6H2,1H3,(H,12,14,15); |
| InChIKey | LVSUUTXGFXQELK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |