About 1-butyl-2-methylpyrrole
1-butyl-2-methylpyrrole (PubChem CID 66974034) has the molecular formula C9H15N
and a molecular weight of 137.23 g/mol. Its IUPAC name is 1-butyl-2-methylpyrrole.
Molecular Properties
| Compound Name | 1-butyl-2-methylpyrrole |
| PubChem CID | 66974034 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 1-butyl-2-methylpyrrole |
| SMILES | CCCCn1cccc1C |
| InChI | InChI=1S/C9H15N/c1-3-4-7-10-8-5-6-9(10)2/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | LFYLKWMUMONXGM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-butyl-2-methylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2-methylpyrrole?
The IUPAC name of 1-butyl-2-methylpyrrole (CID 66974034) is 1-butyl-2-methylpyrrole.
What is the SMILES notation for 1-butyl-2-methylpyrrole?
The canonical SMILES for 1-butyl-2-methylpyrrole is CCCCn1cccc1C.
What is the InChIKey of 1-butyl-2-methylpyrrole?
The InChIKey is LFYLKWMUMONXGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N/c1-3-4-7-10-8-5-6-9(10)2/h5-6,8H,3-4,7H2,1-2H3.
What are the key properties of 1-butyl-2-methylpyrrole?
1-butyl-2-methylpyrrole has a molecular weight of 137.23 g/mol, XLogP of 2.60, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2-methylpyrrole is sourced from PubChem (CID 66974034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).