C12H13NO4 — CID 114239608
5-(3-propoxyphenyl)-1,3-oxazolidine-2,4-dione (PubChem CID 114239608) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is 5-(3-propoxyphenyl)-1,3-oxazolidine-2,4-dione.
| Compound Name | 5-(3-propoxyphenyl)-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 114239608 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 5-(3-propoxyphenyl)-1,3-oxazolidine-2,4-dione |
| SMILES | CCCOc1cccc(C2OC(=O)NC2=O)c1 |
| InChI | InChI=1S/C12H13NO4/c1-2-6-16-9-5-3-4-8(7-9)10-11(14)13-12(15)17-10/h3-5,7,10H,2,6H2,1H3,(H,13,14,15) |
| InChIKey | ZCMJYVBIQNURKY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |