C14H17NO4 — CID 59172842
1-methoxy-3-(3-propoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 59172842) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is 1-methoxy-3-(3-propoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | 1-methoxy-3-(3-propoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 59172842 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 1-methoxy-3-(3-propoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | CCCOc1cccc(C2CC(=O)N(OC)C2=O)c1 |
| InChI | InChI=1S/C14H17NO4/c1-3-7-19-11-6-4-5-10(8-11)12-9-13(16)15(18-2)14(12)17/h4-6,8,12H,3,7,9H2,1-2H3 |
| InChIKey | RLVYHGUMHDKIBU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|