C10H6F3NO3 — CID 13092013
5-[3-(trifluoromethyl)phenyl]-1,3-oxazolidine-2,4-dione (PubChem CID 13092013) has the molecular formula C10H6F3NO3 and a molecular weight of 245.16 g/mol. Its IUPAC name is 5-[3-(trifluoromethyl)phenyl]-1,3-oxazolidine-2,4-dione.
| Compound Name | 5-[3-(trifluoromethyl)phenyl]-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 13092013 |
| Molecular Formula | C10H6F3NO3 |
| Molecular Weight | 245.16 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 5-[3-(trifluoromethyl)phenyl]-1,3-oxazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(c2cccc(C(F)(F)F)c2)O1 |
| InChI | InChI=1S/C10H6F3NO3/c11-10(12,13)6-3-1-2-5(4-6)7-8(15)14-9(16)17-7/h1-4,7H,(H,14,15,16) |
| InChIKey | FJLSWFYFARDZHG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.16 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |