C15H10F3NOS — CID 14715205
2-[3-(trifluoromethyl)phenyl]-4H-1,4-benzothiazin-3-one (PubChem CID 14715205) has the molecular formula C15H10F3NOS and a molecular weight of 309.31 g/mol. Its IUPAC name is 2-[3-(trifluoromethyl)phenyl]-4H-1,4-benzothiazin-3-one.
| Compound Name | 2-[3-(trifluoromethyl)phenyl]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 14715205 |
| Molecular Formula | C15H10F3NOS |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 2-[3-(trifluoromethyl)phenyl]-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1Nc2ccccc2SC1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H10F3NOS/c16-15(17,18)10-5-3-4-9(8-10)13-14(20)19-11-6-1-2-7-12(11)21-13/h1-8,13H,(H,19,20) |
| InChIKey | HLDMQOVPWASBIS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |