C13H13F3O — CID 81416408
2-ethyl-3-[3-(trifluoromethyl)phenyl]cyclobutan-1-one (PubChem CID 81416408) has the molecular formula C13H13F3O and a molecular weight of 242.24 g/mol. Its IUPAC name is 2-ethyl-3-[3-(trifluoromethyl)phenyl]cyclobutan-1-one.
| Compound Name | 2-ethyl-3-[3-(trifluoromethyl)phenyl]cyclobutan-1-one |
|---|---|
| PubChem CID | 81416408 |
| Molecular Formula | C13H13F3O |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2-ethyl-3-[3-(trifluoromethyl)phenyl]cyclobutan-1-one |
| SMILES | CCC1C(=O)CC1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F3O/c1-2-10-11(7-12(10)17)8-4-3-5-9(6-8)13(14,15)16/h3-6,10-11H,2,7H2,1H3 |
| InChIKey | PBSAVPGMMATTKF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |