C20H17F6NO — CID 71341015
4-ethyl-1,3-bis[3-(trifluoromethyl)phenyl]pyrrolidin-2-one (PubChem CID 71341015) has the molecular formula C20H17F6NO and a molecular weight of 401.35 g/mol. Its IUPAC name is 4-ethyl-1,3-bis[3-(trifluoromethyl)phenyl]pyrrolidin-2-one.
| Compound Name | 4-ethyl-1,3-bis[3-(trifluoromethyl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 71341015 |
| Molecular Formula | C20H17F6NO |
| Molecular Weight | 401.35 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 4-ethyl-1,3-bis[3-(trifluoromethyl)phenyl]pyrrolidin-2-one |
| SMILES | CCC1CN(c2cccc(C(F)(F)F)c2)C(=O)C1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H17F6NO/c1-2-12-11-27(16-8-4-7-15(10-16)20(24,25)26)18(28)17(12)13-5-3-6-14(9-13)19(21,22)23/h3-10,12,17H,2,11H2,1H3 |
| InChIKey | NNGYUMCCHLIOTR-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.35 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |