C17H16F3NO — CID 69151810
(1S,2R,6S,7R)-4-[3-(trifluoromethyl)phenyl]-4-azatricyclo[5.2.2.02,6]undec-8-en-3-one (PubChem CID 69151810) has the molecular formula C17H16F3NO and a molecular weight of 307.31 g/mol. Its IUPAC name is (1S,2R,6S,7R)-4-[3-(trifluoromethyl)phenyl]-4-azatricyclo[5.2.2.02,6]undec-8-en-3-one.
| Compound Name | (1S,2R,6S,7R)-4-[3-(trifluoromethyl)phenyl]-4-azatricyclo[5.2.2.02,6]undec-8-en-3-one |
|---|---|
| PubChem CID | 69151810 |
| Molecular Formula | C17H16F3NO |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (1S,2R,6S,7R)-4-[3-(trifluoromethyl)phenyl]-4-azatricyclo[5.2.2.02,6]undec-8-en-3-one |
| SMILES | O=C1[C@H]2[C@@H](CN1c1cccc(C(F)(F)F)c1)[C@H]1C=C[C@@H]2CC1 |
| InChI | InChI=1S/C17H16F3NO/c18-17(19,20)12-2-1-3-13(8-12)21-9-14-10-4-6-11(7-5-10)15(14)16(21)22/h1-4,6,8,10-11,14-15H,5,7,9H2/t10-,11+,14-,15+/m0/s1 |
| InChIKey | JWAXGEHEKUAEAU-IDTSFGKNSA-N |
| XLogP | 3.88 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|