C29H24BrF3NOP — CID 140976510
3-[bromo(triphenyl)-λ5-phosphanyl]-1-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one (PubChem CID 140976510) has the molecular formula C29H24BrF3NOP and a molecular weight of 570.39 g/mol. Its IUPAC name is 3-[bromo(triphenyl)-λ5-phosphanyl]-1-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one.
| Compound Name | 3-[bromo(triphenyl)-λ5-phosphanyl]-1-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 140976510 |
| Molecular Formula | C29H24BrF3NOP |
| Molecular Weight | 570.39 g/mol |
| Exact Mass | 569.07 |
| IUPAC Name | 3-[bromo(triphenyl)-λ5-phosphanyl]-1-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one |
| SMILES | O=C1C(P(Br)(c2ccccc2)(c2ccccc2)c2ccccc2)CCN1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H24BrF3NOP/c30-36(24-13-4-1-5-14-24,25-15-6-2-7-16-25,26-17-8-3-9-18-26)27-19-20-34(28(27)35)23-12-10-11-22(21-23)29(31,32)33/h1-18,21,27H,19-20H2 |
| InChIKey | HMWACPXCMBWUQR-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.39 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|