C18H17F3N2O — CID 13284556
5-methyl-1-phenyl-3-[3-(trifluoromethyl)phenyl]-1,3-diazinan-2-one (PubChem CID 13284556) has the molecular formula C18H17F3N2O and a molecular weight of 334.34 g/mol. Its IUPAC name is 5-methyl-1-phenyl-3-[3-(trifluoromethyl)phenyl]-1,3-diazinan-2-one.
| Compound Name | 5-methyl-1-phenyl-3-[3-(trifluoromethyl)phenyl]-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 13284556 |
| Molecular Formula | C18H17F3N2O |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 5-methyl-1-phenyl-3-[3-(trifluoromethyl)phenyl]-1,3-diazinan-2-one |
| SMILES | CC1CN(c2ccccc2)C(=O)N(c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C18H17F3N2O/c1-13-11-22(15-7-3-2-4-8-15)17(24)23(12-13)16-9-5-6-14(10-16)18(19,20)21/h2-10,13H,11-12H2,1H3 |
| InChIKey | KBLAQPQAYCNENT-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |