About [4-oxo-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-yl] acetate
[4-oxo-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-yl] acetate (PubChem CID 154239323) has the molecular formula C12H10F3NO3S
and a molecular weight of 305.28 g/mol. Its IUPAC name is [4-oxo-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-yl] acetate.
Molecular Properties
| Compound Name | [4-oxo-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-yl] acetate |
| PubChem CID | 154239323 |
| Molecular Formula | C12H10F3NO3S |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | [4-oxo-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-yl] acetate |
| SMILES | CC(=O)OC1SCN(c2cccc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C12H10F3NO3S/c1-7(17)19-11-10(18)16(6-20-11)9-4-2-3-8(5-9)12(13,14)15/h2-5,11H,6H2,1H3 |
| InChIKey | CGDYKIGEQAGASI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-oxo-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-oxo-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-yl] acetate?
The IUPAC name of [4-oxo-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-yl] acetate (CID 154239323) is [4-oxo-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-yl] acetate.
What is the SMILES notation for [4-oxo-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-yl] acetate?
The canonical SMILES for [4-oxo-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-yl] acetate is CC(=O)OC1SCN(c2cccc(C(F)(F)F)c2)C1=O.
What is the InChIKey of [4-oxo-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-yl] acetate?
The InChIKey is CGDYKIGEQAGASI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F3NO3S/c1-7(17)19-11-10(18)16(6-20-11)9-4-2-3-8(5-9)12(13,14)15/h2-5,11H,6H2,1H3.
What are the key properties of [4-oxo-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-yl] acetate?
[4-oxo-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-yl] acetate has a molecular weight of 305.28 g/mol, XLogP of 2.63, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-oxo-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-yl] acetate is sourced from PubChem (CID 154239323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).