C20H21F3N2O2 — CID 46035768
4-[(4-methoxyphenyl)methyl]-3-methyl-1-[3-(trifluoromethyl)phenyl]piperazin-2-one (PubChem CID 46035768) has the molecular formula C20H21F3N2O2 and a molecular weight of 378.39 g/mol. Its IUPAC name is 4-[(4-methoxyphenyl)methyl]-3-methyl-1-[3-(trifluoromethyl)phenyl]piperazin-2-one.
| Compound Name | 4-[(4-methoxyphenyl)methyl]-3-methyl-1-[3-(trifluoromethyl)phenyl]piperazin-2-one |
|---|---|
| PubChem CID | 46035768 |
| Molecular Formula | C20H21F3N2O2 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 4-[(4-methoxyphenyl)methyl]-3-methyl-1-[3-(trifluoromethyl)phenyl]piperazin-2-one |
| SMILES | COc1ccc(CN2CCN(c3cccc(C(F)(F)F)c3)C(=O)C2C)cc1 |
| InChI | InChI=1S/C20H21F3N2O2/c1-14-19(26)25(17-5-3-4-16(12-17)20(21,22)23)11-10-24(14)13-15-6-8-18(27-2)9-7-15/h3-9,12,14H,10-11,13H2,1-2H3 |
| InChIKey | KKUQLKQCHDWPJJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |