C21H20F3N3O3 — CID 11886510
(4aS,7aR)-1-[(4-methoxyphenyl)methyl]-3-[3-(trifluoromethyl)phenyl]-5,6,7,7a-tetrahydro-4aH-pyrrolo[3,2-d]pyrimidine-2,4-dione (PubChem CID 11886510) has the molecular formula C21H20F3N3O3 and a molecular weight of 419.40 g/mol. Its IUPAC name is (4aS,7aR)-1-[(4-methoxyphenyl)methyl]-3-[3-(trifluoromethyl)phenyl]-5,6,7,7a-tetrahydro-4aH-pyrrolo[3,2-d]pyrimidine-2,4-dione.
| Compound Name | (4aS,7aR)-1-[(4-methoxyphenyl)methyl]-3-[3-(trifluoromethyl)phenyl]-5,6,7,7a-tetrahydro-4aH-pyrrolo[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11886510 |
| Molecular Formula | C21H20F3N3O3 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | (4aS,7aR)-1-[(4-methoxyphenyl)methyl]-3-[3-(trifluoromethyl)phenyl]-5,6,7,7a-tetrahydro-4aH-pyrrolo[3,2-d]pyrimidine-2,4-dione |
| SMILES | COc1ccc(CN2C(=O)N(c3cccc(C(F)(F)F)c3)C(=O)[C@H]3NCC[C@H]32)cc1 |
| InChI | InChI=1S/C21H20F3N3O3/c1-30-16-7-5-13(6-8-16)12-26-17-9-10-25-18(17)19(28)27(20(26)29)15-4-2-3-14(11-15)21(22,23)24/h2-8,11,17-18,25H,9-10,12H2,1H3/t17-,18+/m1/s1 |
| InChIKey | HIVGXILERWJZSN-MSOLQXFVSA-N |
| XLogP | 3.41 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |