C25H25F3N4O4S — CID 22244159
N-[2-(3,4-dimethoxyphenyl)ethyl]-3,5-dioxo-4-[3-(trifluoromethyl)phenyl]-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carbothioamide (PubChem CID 22244159) has the molecular formula C25H25F3N4O4S and a molecular weight of 534.56 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-3,5-dioxo-4-[3-(trifluoromethyl)phenyl]-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carbothioamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3,5-dioxo-4-[3-(trifluoromethyl)phenyl]-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carbothioamide |
|---|---|
| PubChem CID | 22244159 |
| Molecular Formula | C25H25F3N4O4S |
| Molecular Weight | 534.56 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3,5-dioxo-4-[3-(trifluoromethyl)phenyl]-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carbothioamide |
| SMILES | COc1ccc(CCNC(=S)N2CC3CC2C2C(=O)N(c4cccc(C(F)(F)F)c4)C(=O)N32)cc1OC |
| InChI | InChI=1S/C25H25F3N4O4S/c1-35-19-7-6-14(10-20(19)36-2)8-9-29-23(37)30-13-17-12-18(30)21-22(33)32(24(34)31(17)21)16-5-3-4-15(11-16)25(26,27)28/h3-7,10-11,17-18,21H,8-9,12-13H2,1-2H3,(H,29,37) |
| InChIKey | KJSZSXPKKIOPAY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.56 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|