C25H29N5O5 — CID 73451765
N-(3-acetamidophenyl)-2-[3-[(4-methoxyphenyl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl]acetamide (PubChem CID 73451765) has the molecular formula C25H29N5O5 and a molecular weight of 479.54 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-2-[3-[(4-methoxyphenyl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl]acetamide.
| Compound Name | N-(3-acetamidophenyl)-2-[3-[(4-methoxyphenyl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl]acetamide |
|---|---|
| PubChem CID | 73451765 |
| Molecular Formula | C25H29N5O5 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | N-(3-acetamidophenyl)-2-[3-[(4-methoxyphenyl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl]acetamide |
| SMILES | COc1ccc(CN2C(=O)C3NCCCC3N(CC(=O)Nc3cccc(NC(C)=O)c3)C2=O)cc1 |
| InChI | InChI=1S/C25H29N5O5/c1-16(31)27-18-5-3-6-19(13-18)28-22(32)15-29-21-7-4-12-26-23(21)24(33)30(25(29)34)14-17-8-10-20(35-2)11-9-17/h3,5-6,8-11,13,21,23,26H,4,7,12,14-15H2,1-2H3,(H,27,31)(H,28,32) |
| InChIKey | KKJBQELQHSCZKU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |