C23H26N4O4 — CID 156593243
2-(3-benzyl-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl)-N-(3-methoxyphenyl)acetamide (PubChem CID 156593243) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is 2-(3-benzyl-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl)-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-(3-benzyl-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl)-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 156593243 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 2-(3-benzyl-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl)-N-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(NC(=O)CN2C(=O)N(Cc3ccccc3)C(=O)C3NCCCC32)c1 |
| InChI | InChI=1S/C23H26N4O4/c1-31-18-10-5-9-17(13-18)25-20(28)15-26-19-11-6-12-24-21(19)22(29)27(23(26)30)14-16-7-3-2-4-8-16/h2-5,7-10,13,19,21,24H,6,11-12,14-15H2,1H3,(H,25,28) |
| InChIKey | QBKDMMAKYDUBBU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |