C25H28N4O5 — CID 156590093
methyl 4-[[2-[3-[(4-methylphenyl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl]acetyl]amino]benzoate (PubChem CID 156590093) has the molecular formula C25H28N4O5 and a molecular weight of 464.52 g/mol. Its IUPAC name is methyl 4-[[2-[3-[(4-methylphenyl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[3-[(4-methylphenyl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 156590093 |
| Molecular Formula | C25H28N4O5 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | methyl 4-[[2-[3-[(4-methylphenyl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CN2C(=O)N(Cc3ccc(C)cc3)C(=O)C3NCCCC32)cc1 |
| InChI | InChI=1S/C25H28N4O5/c1-16-5-7-17(8-6-16)14-29-23(31)22-20(4-3-13-26-22)28(25(29)33)15-21(30)27-19-11-9-18(10-12-19)24(32)34-2/h5-12,20,22,26H,3-4,13-15H2,1-2H3,(H,27,30) |
| InChIKey | TYBLGWBHTJGQDC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |