C22H24ClN5O3 — CID 73340327
N-(3-chloro-4-methylphenyl)-2-[2,4-dioxo-3-(pyridin-3-ylmethyl)-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl]acetamide (PubChem CID 73340327) has the molecular formula C22H24ClN5O3 and a molecular weight of 441.92 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-[2,4-dioxo-3-(pyridin-3-ylmethyl)-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl]acetamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-[2,4-dioxo-3-(pyridin-3-ylmethyl)-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl]acetamide |
|---|---|
| PubChem CID | 73340327 |
| Molecular Formula | C22H24ClN5O3 |
| Molecular Weight | 441.92 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-[2,4-dioxo-3-(pyridin-3-ylmethyl)-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)N(Cc3cccnc3)C(=O)C3NCCCC32)cc1Cl |
| InChI | InChI=1S/C22H24ClN5O3/c1-14-6-7-16(10-17(14)23)26-19(29)13-27-18-5-3-9-25-20(18)21(30)28(22(27)31)12-15-4-2-8-24-11-15/h2,4,6-8,10-11,18,20,25H,3,5,9,12-13H2,1H3,(H,26,29) |
| InChIKey | PGMROCWDPJUDOB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.92 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |