C26H30N4O6 — CID 156589793
ethyl 4-[[2-[3-[(4-methoxyphenyl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl]acetyl]amino]benzoate (PubChem CID 156589793) has the molecular formula C26H30N4O6 and a molecular weight of 494.55 g/mol. Its IUPAC name is ethyl 4-[[2-[3-[(4-methoxyphenyl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[3-[(4-methoxyphenyl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 156589793 |
| Molecular Formula | C26H30N4O6 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | ethyl 4-[[2-[3-[(4-methoxyphenyl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CN2C(=O)N(Cc3ccc(OC)cc3)C(=O)C3NCCCC32)cc1 |
| InChI | InChI=1S/C26H30N4O6/c1-3-36-25(33)18-8-10-19(11-9-18)28-22(31)16-29-21-5-4-14-27-23(21)24(32)30(26(29)34)15-17-6-12-20(35-2)13-7-17/h6-13,21,23,27H,3-5,14-16H2,1-2H3,(H,28,31) |
| InChIKey | YPYBVQFVCWOANC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |