C24H26FN5O4 — CID 74527135
N-(3-acetamidophenyl)-2-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl]acetamide (PubChem CID 74527135) has the molecular formula C24H26FN5O4 and a molecular weight of 467.50 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-2-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl]acetamide.
| Compound Name | N-(3-acetamidophenyl)-2-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl]acetamide |
|---|---|
| PubChem CID | 74527135 |
| Molecular Formula | C24H26FN5O4 |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | N-(3-acetamidophenyl)-2-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl]acetamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)CN2C(=O)N(Cc3ccc(F)cc3)C(=O)C3NCCCC32)c1 |
| InChI | InChI=1S/C24H26FN5O4/c1-15(31)27-18-4-2-5-19(12-18)28-21(32)14-29-20-6-3-11-26-22(20)23(33)30(24(29)34)13-16-7-9-17(25)10-8-16/h2,4-5,7-10,12,20,22,26H,3,6,11,13-14H2,1H3,(H,27,31)(H,28,32) |
| InChIKey | IRGBQVHAKSIZQU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |