C21H22FN5O3 — CID 73340319
2-[2,4-dioxo-3-(pyridin-3-ylmethyl)-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl]-N-(2-fluorophenyl)acetamide (PubChem CID 73340319) has the molecular formula C21H22FN5O3 and a molecular weight of 411.44 g/mol. Its IUPAC name is 2-[2,4-dioxo-3-(pyridin-3-ylmethyl)-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[2,4-dioxo-3-(pyridin-3-ylmethyl)-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 73340319 |
| Molecular Formula | C21H22FN5O3 |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 2-[2,4-dioxo-3-(pyridin-3-ylmethyl)-4a,5,6,7,8,8a-hexahydropyrido[3,2-d]pyrimidin-1-yl]-N-(2-fluorophenyl)acetamide |
| SMILES | O=C(CN1C(=O)N(Cc2cccnc2)C(=O)C2NCCCC21)Nc1ccccc1F |
| InChI | InChI=1S/C21H22FN5O3/c22-15-6-1-2-7-16(15)25-18(28)13-26-17-8-4-10-24-19(17)20(29)27(21(26)30)12-14-5-3-9-23-11-14/h1-3,5-7,9,11,17,19,24H,4,8,10,12-13H2,(H,25,28) |
| InChIKey | YUFVLOPQGSJWRV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |