C24H27N3O4 — CID 156589849
2-(3-benzyl-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-1-yl)-N-(3-methoxyphenyl)acetamide (PubChem CID 156589849) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is 2-(3-benzyl-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-1-yl)-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-(3-benzyl-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-1-yl)-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 156589849 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 2-(3-benzyl-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-1-yl)-N-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(NC(=O)CN2C(=O)N(Cc3ccccc3)C(=O)C3CCCCC32)c1 |
| InChI | InChI=1S/C24H27N3O4/c1-31-19-11-7-10-18(14-19)25-22(28)16-26-21-13-6-5-12-20(21)23(29)27(24(26)30)15-17-8-3-2-4-9-17/h2-4,7-11,14,20-21H,5-6,12-13,15-16H2,1H3,(H,25,28) |
| InChIKey | KAQSXRCBYQSJCI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |